About 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde
2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde (PubChem CID 89272165) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde |
| PubChem CID | 89272165 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde |
| SMILES | COC1=C(C=O)CCC=C1C=O |
| InChI | InChI=1S/C9H10O3/c1-12-9-7(5-10)3-2-4-8(9)6-11/h3,5-6H,2,4H2,1H3 |
| InChIKey | QVFZZOXYVIIBPH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde?
The IUPAC name of 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde (CID 89272165) is 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde.
What is the SMILES notation for 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde?
The canonical SMILES for 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde is COC1=C(C=O)CCC=C1C=O.
What is the InChIKey of 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde?
The InChIKey is QVFZZOXYVIIBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-12-9-7(5-10)3-2-4-8(9)6-11/h3,5-6H,2,4H2,1H3.
What are the key properties of 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde?
2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde has a molecular weight of 166.18 g/mol, XLogP of 1.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxycyclohexa-1,3-diene-1,3-dicarbaldehyde is sourced from PubChem (CID 89272165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).