C11H20N6 — CID 89272215
N'-[(3Z)-4-hydrazinylpenta-1,3-dien-2-yl]-N-(5-methyl-1H-pyrazol-3-yl)ethane-1,2-diamine (PubChem CID 89272215) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is N'-[(3Z)-4-hydrazinylpenta-1,3-dien-2-yl]-N-(5-methyl-1H-pyrazol-3-yl)ethane-1,2-diamine.
| Compound Name | N'-[(3Z)-4-hydrazinylpenta-1,3-dien-2-yl]-N-(5-methyl-1H-pyrazol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 89272215 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N'-[(3Z)-4-hydrazinylpenta-1,3-dien-2-yl]-N-(5-methyl-1H-pyrazol-3-yl)ethane-1,2-diamine |
| SMILES | C=C(/C=C(/C)NN)NCCNc1cc(C)[nH]n1 |
| InChI | InChI=1S/C11H20N6/c1-8(6-9(2)15-12)13-4-5-14-11-7-10(3)16-17-11/h6-7,13,15H,1,4-5,12H2,2-3H3,(H2,14,16,17)/b9-6- |
| InChIKey | BHESROCUIBKMNH-TWGQIWQCSA-N |
| XLogP | 0.60 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|