C18H18F4N4O2S — CID 89272255
3-amino-N-[(1R)-1-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]ethyl]-4-fluorobenzenesulfonamide (PubChem CID 89272255) has the molecular formula C18H18F4N4O2S and a molecular weight of 430.43 g/mol. Its IUPAC name is 3-amino-N-[(1R)-1-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-amino-N-[(1R)-1-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 89272255 |
| Molecular Formula | C18H18F4N4O2S |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-amino-N-[(1R)-1-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]ethyl]-4-fluorobenzenesulfonamide |
| SMILES | CCn1c([C@@H](C)NS(=O)(=O)c2ccc(F)c(N)c2)nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H18F4N4O2S/c1-3-26-16-8-11(18(20,21)22)4-7-15(16)24-17(26)10(2)25-29(27,28)12-5-6-13(19)14(23)9-12/h4-10,25H,3,23H2,1-2H3/t10-/m1/s1 |
| InChIKey | DCCRRVMYIFIIEL-SNVBAGLBSA-N |
| XLogP | 3.84 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|