About N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine
N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine (PubChem CID 89272292) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine.
Molecular Properties
| Compound Name | N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine |
| PubChem CID | 89272292 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine |
| SMILES | C=NC1=CCCC=C1SC |
| InChI | InChI=1S/C8H11NS/c1-9-7-5-3-4-6-8(7)10-2/h5-6H,1,3-4H2,2H3 |
| InChIKey | YCNGEPHRWXYVOY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine?
The IUPAC name of N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine (CID 89272292) is N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine.
What is the SMILES notation for N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine?
The canonical SMILES for N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine is C=NC1=CCCC=C1SC.
What is the InChIKey of N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine?
The InChIKey is YCNGEPHRWXYVOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-9-7-5-3-4-6-8(7)10-2/h5-6H,1,3-4H2,2H3.
What are the key properties of N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine?
N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine has a molecular weight of 153.25 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanimine is sourced from PubChem (CID 89272292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).