C10H17NS — CID 89272406
6-ethyl-2-methyl-2,3,3a,4,7,7a-hexahydro-1,3-benzothiazole (PubChem CID 89272406) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is 6-ethyl-2-methyl-2,3,3a,4,7,7a-hexahydro-1,3-benzothiazole.
| Compound Name | 6-ethyl-2-methyl-2,3,3a,4,7,7a-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 89272406 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 6-ethyl-2-methyl-2,3,3a,4,7,7a-hexahydro-1,3-benzothiazole |
| SMILES | CCC1=CCC2NC(C)SC2C1 |
| InChI | InChI=1S/C10H17NS/c1-3-8-4-5-9-10(6-8)12-7(2)11-9/h4,7,9-11H,3,5-6H2,1-2H3 |
| InChIKey | UPIGBWGBIZUBPB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|