About (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole
(5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole (PubChem CID 89272485) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole.
Molecular Properties
| Compound Name | (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole |
| PubChem CID | 89272485 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole |
| SMILES | C=c1nc(C)s/c1=C/C=C\C |
| InChI | InChI=1S/C9H11NS/c1-4-5-6-9-7(2)10-8(3)11-9/h4-6H,2H2,1,3H3/b5-4-,9-6+ |
| InChIKey | AIGXHMYNXBWRKX-KMOPYBJPSA-N |
| XLogP | 1.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole?
The IUPAC name of (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole (CID 89272485) is (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole.
What is the SMILES notation for (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole?
The canonical SMILES for (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole is C=c1nc(C)s/c1=C/C=C\C.
What is the InChIKey of (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole?
The InChIKey is AIGXHMYNXBWRKX-KMOPYBJPSA-N. The full InChI is InChI=1S/C9H11NS/c1-4-5-6-9-7(2)10-8(3)11-9/h4-6H,2H2,1,3H3/b5-4-,9-6+.
What are the key properties of (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole?
(5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole has a molecular weight of 165.26 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-methylidene-1,3-thiazole is sourced from PubChem (CID 89272485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).