C18H19Cl2N5O — CID 89272526
N'-[4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 89272526) has the molecular formula C18H19Cl2N5O and a molecular weight of 392.29 g/mol. Its IUPAC name is N'-[4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 89272526 |
| Molecular Formula | C18H19Cl2N5O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N'-[4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CC(C)Oc1cc(-c2nc(/N=C\N(C)C)nc3cc[nH]c23)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N5O/c1-10(2)26-15-7-11(12(19)8-13(15)20)16-17-14(5-6-21-17)23-18(24-16)22-9-25(3)4/h5-10,21H,1-4H3/b22-9- |
| InChIKey | CVXNABHXEAWDHW-AFPJDJCSSA-N |
| XLogP | 4.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|