C19H33O3P — CID 89272554
(1E,4E,6E)-1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,4,6,10-tetraene (PubChem CID 89272554) has the molecular formula C19H33O3P and a molecular weight of 340.44 g/mol. Its IUPAC name is (1E,4E,6E)-1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,4,6,10-tetraene.
| Compound Name | (1E,4E,6E)-1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,4,6,10-tetraene |
|---|---|
| PubChem CID | 89272554 |
| Molecular Formula | C19H33O3P |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (1E,4E,6E)-1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,4,6,10-tetraene |
| SMILES | CCOP(=O)(/C=C/C(C)/C=C/C=C(\C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C19H33O3P/c1-7-21-23(20,22-8-2)16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h10-11,13-16,19H,7-9,12H2,1-6H3/b14-10+,16-15+,18-13+ |
| InChIKey | AZAIARJSQJSCLO-NWSPVTERSA-N |
| XLogP | 6.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|