C24H28F20O3Si — CID 89272589
[3,4,4,5,6,6,7,7,8,8,9,9,10,10-tetradecafluoro-12-triethylsilyloxy-3,5-bis(trifluoromethyl)dodecyl] 2-methylprop-2-enoate (PubChem CID 89272589) has the molecular formula C24H28F20O3Si and a molecular weight of 772.53 g/mol. Its IUPAC name is [3,4,4,5,6,6,7,7,8,8,9,9,10,10-tetradecafluoro-12-triethylsilyloxy-3,5-bis(trifluoromethyl)dodecyl] 2-methylprop-2-enoate.
| Compound Name | [3,4,4,5,6,6,7,7,8,8,9,9,10,10-tetradecafluoro-12-triethylsilyloxy-3,5-bis(trifluoromethyl)dodecyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89272589 |
| Molecular Formula | C24H28F20O3Si |
| Molecular Weight | 772.53 g/mol |
| Exact Mass | 772.15 |
| IUPAC Name | [3,4,4,5,6,6,7,7,8,8,9,9,10,10-tetradecafluoro-12-triethylsilyloxy-3,5-bis(trifluoromethyl)dodecyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCO[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H28F20O3Si/c1-6-48(7-2,8-3)47-12-10-16(26,27)19(31,32)21(35,36)22(37,38)20(33,34)17(28,24(42,43)44)18(29,30)15(25,23(39,40)41)9-11-46-14(45)13(4)5/h4,6-12H2,1-3,5H3 |
| InChIKey | GDODVMLXFMJCRU-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.53 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|