C18H32O2 — CID 89272658
(3R,5R)-7-[(2S,5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one (PubChem CID 89272658) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (3R,5R)-7-[(2S,5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one.
| Compound Name | (3R,5R)-7-[(2S,5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one |
|---|---|
| PubChem CID | 89272658 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (3R,5R)-7-[(2S,5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one |
| SMILES | C=C1C[C@H](CCCC)O[C@H]1CC[C@@H](C)C[C@@H](C)C(C)=O |
| InChI | InChI=1S/C18H32O2/c1-6-7-8-17-12-15(4)18(20-17)10-9-13(2)11-14(3)16(5)19/h13-14,17-18H,4,6-12H2,1-3,5H3/t13-,14-,17+,18+/m1/s1 |
| InChIKey | BHOIYHGJUCTHIE-KNCCTNLNSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|