About CID 89272695
CID 89272695 (PubChem CID 89272695) has the molecular formula C7H11BO2
and a molecular weight of 137.97 g/mol.
Molecular Properties
| Compound Name | CID 89272695 |
| PubChem CID | 89272695 |
| Molecular Formula | C7H11BO2 |
| Molecular Weight | 137.97 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | — |
| SMILES | [B][C@H]1O[C@@H](CC)C(=C)[C@H]1O |
| InChI | InChI=1S/C7H11BO2/c1-3-5-4(2)6(9)7(8)10-5/h5-7,9H,2-3H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | VEISZTPZDKPMKM-XVMARJQXSA-N |
| XLogP | 0.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.97 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 89272695 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89272695?
The IUPAC name of CID 89272695 (CID 89272695) is not available.
What is the SMILES notation for CID 89272695?
The canonical SMILES for CID 89272695 is [B][C@H]1O[C@@H](CC)C(=C)[C@H]1O.
What is the InChIKey of CID 89272695?
The InChIKey is VEISZTPZDKPMKM-XVMARJQXSA-N. The full InChI is InChI=1S/C7H11BO2/c1-3-5-4(2)6(9)7(8)10-5/h5-7,9H,2-3H2,1H3/t5-,6+,7-/m0/s1.
What are the key properties of CID 89272695?
CID 89272695 has a molecular weight of 137.97 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89272695 is sourced from PubChem (CID 89272695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).