C23H27N7O5 — CID 89272891
2-(1,3-dioxan-2-yl)propan-2-yl N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate (PubChem CID 89272891) has the molecular formula C23H27N7O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yl)propan-2-yl N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate.
| Compound Name | 2-(1,3-dioxan-2-yl)propan-2-yl N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 89272891 |
| Molecular Formula | C23H27N7O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-(1,3-dioxan-2-yl)propan-2-yl N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
| SMILES | Cn1nnnc1/C(=N\OCc1cccc(NC(=O)OC(C)(C)C2OCCCO2)n1)c1ccccc1 |
| InChI | InChI=1S/C23H27N7O5/c1-23(2,21-32-13-8-14-33-21)35-22(31)25-18-12-7-11-17(24-18)15-34-27-19(16-9-5-4-6-10-16)20-26-28-29-30(20)3/h4-7,9-12,21H,8,13-15H2,1-3H3,(H,24,25,31)/b27-19- |
| InChIKey | KXMJCBLMGRWMDW-DIBXZPPDSA-N |
| XLogP | 2.66 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|