C15H27N3O3 — CID 89273124
(2S)-2-[(2-aminoacetyl)amino]-N,3,3-trimethyl-N-[(E)-3-methyl-4-oxopent-2-enyl]butanamide (PubChem CID 89273124) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2S)-2-[(2-aminoacetyl)amino]-N,3,3-trimethyl-N-[(E)-3-methyl-4-oxopent-2-enyl]butanamide.
| Compound Name | (2S)-2-[(2-aminoacetyl)amino]-N,3,3-trimethyl-N-[(E)-3-methyl-4-oxopent-2-enyl]butanamide |
|---|---|
| PubChem CID | 89273124 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (2S)-2-[(2-aminoacetyl)amino]-N,3,3-trimethyl-N-[(E)-3-methyl-4-oxopent-2-enyl]butanamide |
| SMILES | CC(=O)/C(C)=C/CN(C)C(=O)[C@@H](NC(=O)CN)C(C)(C)C |
| InChI | InChI=1S/C15H27N3O3/c1-10(11(2)19)7-8-18(6)14(21)13(15(3,4)5)17-12(20)9-16/h7,13H,8-9,16H2,1-6H3,(H,17,20)/b10-7+/t13-/m1/s1 |
| InChIKey | DQTFHBFDOZJEEP-UTSBKAFOSA-N |
| XLogP | 0.47 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|