C16H27N3O3 — CID 89273202
N-[(E,3S)-2,5-dimethyl-6-oxo-6-pyrrolidin-1-ylhex-4-en-3-yl]-2-formamido-N-methylacetamide (PubChem CID 89273202) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[(E,3S)-2,5-dimethyl-6-oxo-6-pyrrolidin-1-ylhex-4-en-3-yl]-2-formamido-N-methylacetamide.
| Compound Name | N-[(E,3S)-2,5-dimethyl-6-oxo-6-pyrrolidin-1-ylhex-4-en-3-yl]-2-formamido-N-methylacetamide |
|---|---|
| PubChem CID | 89273202 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[(E,3S)-2,5-dimethyl-6-oxo-6-pyrrolidin-1-ylhex-4-en-3-yl]-2-formamido-N-methylacetamide |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H27N3O3/c1-12(2)14(18(4)15(21)10-17-11-20)9-13(3)16(22)19-7-5-6-8-19/h9,11-12,14H,5-8,10H2,1-4H3,(H,17,20)/b13-9+/t14-/m1/s1 |
| InChIKey | XYUAKGNNSXUPTP-KADHNRKRSA-N |
| XLogP | 0.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|