C16H29N3O3 — CID 89273248
(E,4S)-N,N-diethyl-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enamide (PubChem CID 89273248) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is (E,4S)-N,N-diethyl-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enamide.
| Compound Name | (E,4S)-N,N-diethyl-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 89273248 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (E,4S)-N,N-diethyl-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enamide |
| SMILES | CCN(CC)C(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC=O |
| InChI | InChI=1S/C16H29N3O3/c1-7-19(8-2)16(22)13(5)9-14(12(3)4)18(6)15(21)10-17-11-20/h9,11-12,14H,7-8,10H2,1-6H3,(H,17,20)/b13-9+/t14-/m1/s1 |
| InChIKey | ZCBPNDDIUXOGPJ-KADHNRKRSA-N |
| XLogP | 1.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|