C14H26N4O3 — CID 89273252
N-[(E,3S)-6-(2,2-dimethylhydrazinyl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide (PubChem CID 89273252) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[(E,3S)-6-(2,2-dimethylhydrazinyl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide.
| Compound Name | N-[(E,3S)-6-(2,2-dimethylhydrazinyl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide |
|---|---|
| PubChem CID | 89273252 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-[(E,3S)-6-(2,2-dimethylhydrazinyl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)NN(C)C |
| InChI | InChI=1S/C14H26N4O3/c1-10(2)12(18(6)13(20)8-15-9-19)7-11(3)14(21)16-17(4)5/h7,9-10,12H,8H2,1-6H3,(H,15,19)(H,16,21)/b11-7+/t12-/m1/s1 |
| InChIKey | MXFBBKNXGYIQGH-YTRUQHMWSA-N |
| XLogP | -0.25 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|