C15H26N2O4 — CID 89273330
ethyl (E)-4-[[(2R)-2-formamido-3,3-dimethylbutanoyl]-methylamino]-2-methylbut-2-enoate (PubChem CID 89273330) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl (E)-4-[[(2R)-2-formamido-3,3-dimethylbutanoyl]-methylamino]-2-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[[(2R)-2-formamido-3,3-dimethylbutanoyl]-methylamino]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 89273330 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | ethyl (E)-4-[[(2R)-2-formamido-3,3-dimethylbutanoyl]-methylamino]-2-methylbut-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CN(C)C(=O)[C@H](NC=O)C(C)(C)C |
| InChI | InChI=1S/C15H26N2O4/c1-7-21-14(20)11(2)8-9-17(6)13(19)12(16-10-18)15(3,4)5/h8,10,12H,7,9H2,1-6H3,(H,16,18)/b11-8+/t12-/m0/s1 |
| InChIKey | PNCIQNFRVBGIAP-OBIHZWKSSA-N |
| XLogP | 1.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|