C14H24FN3O3 — CID 89273339
(E,4S)-N-(2-fluoroethyl)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enamide (PubChem CID 89273339) has the molecular formula C14H24FN3O3 and a molecular weight of 301.36 g/mol. Its IUPAC name is (E,4S)-N-(2-fluoroethyl)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enamide.
| Compound Name | (E,4S)-N-(2-fluoroethyl)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 89273339 |
| Molecular Formula | C14H24FN3O3 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (E,4S)-N-(2-fluoroethyl)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enamide |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)NCCF |
| InChI | InChI=1S/C14H24FN3O3/c1-10(2)12(18(4)13(20)8-16-9-19)7-11(3)14(21)17-6-5-15/h7,9-10,12H,5-6,8H2,1-4H3,(H,16,19)(H,17,21)/b11-7+/t12-/m1/s1 |
| InChIKey | LDOGFNJULFGYNL-YTRUQHMWSA-N |
| XLogP | 0.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|