C19H31FN4O4 — CID 89273402
N-(2-fluoroethyl)-1-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxamide (PubChem CID 89273402) has the molecular formula C19H31FN4O4 and a molecular weight of 398.48 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-fluoroethyl)-1-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89273402 |
| Molecular Formula | C19H31FN4O4 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-(2-fluoroethyl)-1-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxamide |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCCC1C(=O)NCCF |
| InChI | InChI=1S/C19H31FN4O4/c1-13(2)16(23(4)17(26)11-21-12-25)10-14(3)19(28)24-9-5-6-15(24)18(27)22-8-7-20/h10,12-13,15-16H,5-9,11H2,1-4H3,(H,21,25)(H,22,27)/b14-10+/t15?,16-/m1/s1 |
| InChIKey | WIWRLUROMKQJKE-IDQLDTIISA-N |
| XLogP | 0.24 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|