About 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid
6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid (PubChem CID 89273591) has the molecular formula C9H10F2N4O4
and a molecular weight of 276.20 g/mol. Its IUPAC name is 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid |
| PubChem CID | 89273591 |
| Molecular Formula | C9H10F2N4O4 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid |
| SMILES | CN(CC(F)F)c1nc(N)c([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C9H10F2N4O4/c1-14(3-6(10)11)8-4(9(16)17)2-5(15(18)19)7(12)13-8/h2,6H,3H2,1H3,(H2,12,13)(H,16,17) |
| InChIKey | GECVMYZXNJWXIF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 122.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid?
The IUPAC name of 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid (CID 89273591) is 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid.
What is the SMILES notation for 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid?
The canonical SMILES for 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid is CN(CC(F)F)c1nc(N)c([N+](=O)[O-])cc1C(=O)O.
What is the InChIKey of 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid?
The InChIKey is GECVMYZXNJWXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N4O4/c1-14(3-6(10)11)8-4(9(16)17)2-5(15(18)19)7(12)13-8/h2,6H,3H2,1H3,(H2,12,13)(H,16,17).
What are the key properties of 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid?
6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid has a molecular weight of 276.20 g/mol, XLogP of 0.97, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-[2,2-difluoroethyl(methyl)amino]-5-nitropyridine-3-carboxylic acid is sourced from PubChem (CID 89273591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).