C9H16N2O2 — CID 89273664
5-(4,4-dimethylpentan-2-yl)-3H-1,3,4-oxadiazol-2-one (PubChem CID 89273664) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-(4,4-dimethylpentan-2-yl)-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(4,4-dimethylpentan-2-yl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 89273664 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5-(4,4-dimethylpentan-2-yl)-3H-1,3,4-oxadiazol-2-one |
| SMILES | CC(CC(C)(C)C)c1n[nH]c(=O)o1 |
| InChI | InChI=1S/C9H16N2O2/c1-6(5-9(2,3)4)7-10-11-8(12)13-7/h6H,5H2,1-4H3,(H,11,12) |
| InChIKey | SWEQSIDBHKOJRG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |