About 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene
1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene (PubChem CID 89273805) has the molecular formula C11H12F2
and a molecular weight of 182.21 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene |
| PubChem CID | 89273805 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene |
| SMILES | C/C=C/Cc1ccc(C)c(F)c1F |
| InChI | InChI=1S/C11H12F2/c1-3-4-5-9-7-6-8(2)10(12)11(9)13/h3-4,6-7H,5H2,1-2H3/b4-3+ |
| InChIKey | SSRRPVVQRVJEEQ-ONEGZZNKSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene?
The IUPAC name of 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene (CID 89273805) is 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene.
What is the SMILES notation for 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene?
The canonical SMILES for 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene is C/C=C/Cc1ccc(C)c(F)c1F.
What is the InChIKey of 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene?
The InChIKey is SSRRPVVQRVJEEQ-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H12F2/c1-3-4-5-9-7-6-8(2)10(12)11(9)13/h3-4,6-7H,5H2,1-2H3/b4-3+.
What are the key properties of 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene?
1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene has a molecular weight of 182.21 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-2-enyl]-2,3-difluoro-4-methylbenzene is sourced from PubChem (CID 89273805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).