C18H30O7S — CID 89274384
[(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]methyl hydrogen sulfate (PubChem CID 89274384) has the molecular formula C18H30O7S and a molecular weight of 390.50 g/mol. Its IUPAC name is [(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]methyl hydrogen sulfate.
| Compound Name | [(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 89274384 |
| Molecular Formula | C18H30O7S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]methyl hydrogen sulfate |
| SMILES | C[C@@]1(C2CC3CCCC(C3)C2)OOC2(CCC(COS(=O)(=O)O)CC2)O1 |
| InChI | InChI=1S/C18H30O7S/c1-17(16-10-14-3-2-4-15(9-14)11-16)23-18(25-24-17)7-5-13(6-8-18)12-22-26(19,20)21/h13-16H,2-12H2,1H3,(H,19,20,21)/t13?,14?,15?,16?,17-,18?/m0/s1 |
| InChIKey | KWABAQVILKNXPF-NFSPANSCSA-N |
| XLogP | 3.60 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|