C27H28FNO4S — CID 89274467
[(1R,8R,9R,10S)-8-(4-fluorophenyl)sulfanyl-12-methoxy-4,17-dimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] acetate (PubChem CID 89274467) has the molecular formula C27H28FNO4S and a molecular weight of 481.59 g/mol. Its IUPAC name is [(1R,8R,9R,10S)-8-(4-fluorophenyl)sulfanyl-12-methoxy-4,17-dimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] acetate.
| Compound Name | [(1R,8R,9R,10S)-8-(4-fluorophenyl)sulfanyl-12-methoxy-4,17-dimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] acetate |
|---|---|
| PubChem CID | 89274467 |
| Molecular Formula | C27H28FNO4S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [(1R,8R,9R,10S)-8-(4-fluorophenyl)sulfanyl-12-methoxy-4,17-dimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] acetate |
| SMILES | COC1=C[C@@H]2[C@@H]3[C@H](Sc4ccc(F)cc4)c4ccc(C)c(OC(C)=O)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C27H28FNO4S/c1-15-5-10-19-23(25(15)33-16(2)30)27-11-12-29(3)24(20(27)13-22(32-4)21(31)14-27)26(19)34-18-8-6-17(28)7-9-18/h5-10,13,20,24,26H,11-12,14H2,1-4H3/t20-,24-,26-,27-/m1/s1 |
| InChIKey | FPTROGZKMUDGEG-RXTZQXTGSA-N |
| XLogP | 4.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|