C25H24F3NO4S — CID 89274474
(1R,8R,9R,10S)-3,4-dihydroxy-12-methoxy-17-methyl-8-[4-(trifluoromethyl)phenyl]sulfanyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (PubChem CID 89274474) has the molecular formula C25H24F3NO4S and a molecular weight of 491.53 g/mol. Its IUPAC name is (1R,8R,9R,10S)-3,4-dihydroxy-12-methoxy-17-methyl-8-[4-(trifluoromethyl)phenyl]sulfanyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.
| Compound Name | (1R,8R,9R,10S)-3,4-dihydroxy-12-methoxy-17-methyl-8-[4-(trifluoromethyl)phenyl]sulfanyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
|---|---|
| PubChem CID | 89274474 |
| Molecular Formula | C25H24F3NO4S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (1R,8R,9R,10S)-3,4-dihydroxy-12-methoxy-17-methyl-8-[4-(trifluoromethyl)phenyl]sulfanyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| SMILES | COC1=C[C@@H]2[C@@H]3[C@H](Sc4ccc(C(F)(F)F)cc4)c4ccc(O)c(O)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C25H24F3NO4S/c1-29-10-9-24-12-18(31)19(33-2)11-16(24)21(29)23(15-7-8-17(30)22(32)20(15)24)34-14-5-3-13(4-6-14)25(26,27)28/h3-8,11,16,21,23,30,32H,9-10,12H2,1-2H3/t16-,21-,23-,24-/m1/s1 |
| InChIKey | JWLBQIVGYYPLEW-KMBRJESTSA-N |
| XLogP | 5.02 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|