C22H27NO4 — CID 89274476
[(1R,8R,9S)-12-methoxy-4,8,17-trimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] acetate (PubChem CID 89274476) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [(1R,8R,9S)-12-methoxy-4,8,17-trimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] acetate.
| Compound Name | [(1R,8R,9S)-12-methoxy-4,8,17-trimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] acetate |
|---|---|
| PubChem CID | 89274476 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [(1R,8R,9S)-12-methoxy-4,8,17-trimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] acetate |
| SMILES | COC1=CC2[C@@H]3[C@H](C)c4ccc(C)c(OC(C)=O)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C22H27NO4/c1-12-6-7-15-13(2)20-16-10-18(26-5)17(25)11-22(16,8-9-23(20)4)19(15)21(12)27-14(3)24/h6-7,10,13,16,20H,8-9,11H2,1-5H3/t13-,16?,20+,22-/m1/s1 |
| InChIKey | QFLNVYIGQGZHDP-YXFYWXHPSA-N |
| XLogP | 3.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|