C24H24FNO4S — CID 89274485
(1R,8R,9R)-8-(4-fluorophenyl)sulfanyl-3,4-dihydroxy-12-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (PubChem CID 89274485) has the molecular formula C24H24FNO4S and a molecular weight of 441.52 g/mol. Its IUPAC name is (1R,8R,9R)-8-(4-fluorophenyl)sulfanyl-3,4-dihydroxy-12-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.
| Compound Name | (1R,8R,9R)-8-(4-fluorophenyl)sulfanyl-3,4-dihydroxy-12-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
|---|---|
| PubChem CID | 89274485 |
| Molecular Formula | C24H24FNO4S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (1R,8R,9R)-8-(4-fluorophenyl)sulfanyl-3,4-dihydroxy-12-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| SMILES | COC1=CC2[C@@H]3[C@H](Sc4ccc(F)cc4)c4ccc(O)c(O)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C24H24FNO4S/c1-26-10-9-24-12-18(28)19(30-2)11-16(24)21(26)23(31-14-5-3-13(25)4-6-14)15-7-8-17(27)22(29)20(15)24/h3-8,11,16,21,23,27,29H,9-10,12H2,1-2H3/t16?,21-,23-,24-/m1/s1 |
| InChIKey | DUPPAHCWQGYKBY-PWPWUPJCSA-N |
| XLogP | 4.15 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|