C29H28F3NO6S — CID 89274495
[(1R,8R,9R,10S)-3-acetyloxy-12-methoxy-17-methyl-13-oxo-8-[4-(trifluoromethyl)phenyl]sulfanyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-4-yl] acetate (PubChem CID 89274495) has the molecular formula C29H28F3NO6S and a molecular weight of 575.61 g/mol. Its IUPAC name is [(1R,8R,9R,10S)-3-acetyloxy-12-methoxy-17-methyl-13-oxo-8-[4-(trifluoromethyl)phenyl]sulfanyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-4-yl] acetate.
| Compound Name | [(1R,8R,9R,10S)-3-acetyloxy-12-methoxy-17-methyl-13-oxo-8-[4-(trifluoromethyl)phenyl]sulfanyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-4-yl] acetate |
|---|---|
| PubChem CID | 89274495 |
| Molecular Formula | C29H28F3NO6S |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | [(1R,8R,9R,10S)-3-acetyloxy-12-methoxy-17-methyl-13-oxo-8-[4-(trifluoromethyl)phenyl]sulfanyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-4-yl] acetate |
| SMILES | COC1=C[C@@H]2[C@@H]3[C@H](Sc4ccc(C(F)(F)F)cc4)c4ccc(OC(C)=O)c(OC(C)=O)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C29H28F3NO6S/c1-15(34)38-22-10-9-19-24(26(22)39-16(2)35)28-11-12-33(3)25(20(28)13-23(37-4)21(36)14-28)27(19)40-18-7-5-17(6-8-18)29(30,31)32/h5-10,13,20,25,27H,11-12,14H2,1-4H3/t20-,25-,27-,28-/m1/s1 |
| InChIKey | SPXSQPPDVWZWFL-DFHREBLOSA-N |
| XLogP | 5.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|