About 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione
3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione (PubChem CID 89274552) has the molecular formula C16H34O7Si3
and a molecular weight of 422.70 g/mol. Its IUPAC name is 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione.
Molecular Properties
| Compound Name | 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione |
| PubChem CID | 89274552 |
| Molecular Formula | C16H34O7Si3 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione |
| SMILES | CO[Si](OC)(OC)C(C)[Si](C)(C)O[Si](C)(C)C(C)CC1CC(=O)OC1=O |
| InChI | InChI=1S/C16H34O7Si3/c1-12(10-14-11-15(17)22-16(14)18)24(6,7)23-25(8,9)13(2)26(19-3,20-4)21-5/h12-14H,10-11H2,1-9H3 |
| InChIKey | FOCRNVXGVBDMBA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione?
The IUPAC name of 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione (CID 89274552) is 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione.
What is the SMILES notation for 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione?
The canonical SMILES for 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione is CO[Si](OC)(OC)C(C)[Si](C)(C)O[Si](C)(C)C(C)CC1CC(=O)OC1=O.
What is the InChIKey of 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione?
The InChIKey is FOCRNVXGVBDMBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O7Si3/c1-12(10-14-11-15(17)22-16(14)18)24(6,7)23-25(8,9)13(2)26(19-3,20-4)21-5/h12-14H,10-11H2,1-9H3.
What are the key properties of 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione?
3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione has a molecular weight of 422.70 g/mol, XLogP of 3.09, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[[dimethyl(1-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propyl]oxolane-2,5-dione is sourced from PubChem (CID 89274552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).