C10H20O2 — CID 89274647
(2S,3S,4R,6S)-4-methoxy-2,3,4,6-tetramethyloxane (PubChem CID 89274647) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (2S,3S,4R,6S)-4-methoxy-2,3,4,6-tetramethyloxane.
| Compound Name | (2S,3S,4R,6S)-4-methoxy-2,3,4,6-tetramethyloxane |
|---|---|
| PubChem CID | 89274647 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (2S,3S,4R,6S)-4-methoxy-2,3,4,6-tetramethyloxane |
| SMILES | CO[C@]1(C)C[C@H](C)O[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C10H20O2/c1-7-6-10(4,11-5)8(2)9(3)12-7/h7-9H,6H2,1-5H3/t7-,8-,9-,10+/m0/s1 |
| InChIKey | RAVFTDCCDVNJEF-AATLWQCWSA-N |
| XLogP | 2.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |