C10H14O — CID 89274855
3-ethyl-2,5,6,7-tetrahydrocyclopenta[b]pyran (PubChem CID 89274855) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-ethyl-2,5,6,7-tetrahydrocyclopenta[b]pyran.
| Compound Name | 3-ethyl-2,5,6,7-tetrahydrocyclopenta[b]pyran |
|---|---|
| PubChem CID | 89274855 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3-ethyl-2,5,6,7-tetrahydrocyclopenta[b]pyran |
| SMILES | CCC1=CC2=C(CCC2)OC1 |
| InChI | InChI=1S/C10H14O/c1-2-8-6-9-4-3-5-10(9)11-7-8/h6H,2-5,7H2,1H3 |
| InChIKey | OYQLKRLGSSLLPM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |