C21H21BN2O2S — CID 89275031
CID 89275031 (PubChem CID 89275031) has the molecular formula C21H21BN2O2S and a molecular weight of 376.29 g/mol.
| Compound Name | CID 89275031 |
|---|---|
| PubChem CID | 89275031 |
| Molecular Formula | C21H21BN2O2S |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | — |
| SMILES | [B]c1cc([C@@H](c2ccccc2)C(C)(C)C(=O)Nc2nccs2)ccc1OC |
| InChI | InChI=1S/C21H21BN2O2S/c1-21(2,19(25)24-20-23-11-12-27-20)18(14-7-5-4-6-8-14)15-9-10-17(26-3)16(22)13-15/h4-13,18H,1-3H3,(H,23,24,25)/t18-/m1/s1 |
| InChIKey | ARVMOXSNNWFQSL-GOSISDBHSA-N |
| XLogP | 3.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|