C30H44N4O7 — CID 89275215
benzyl N-[(2S)-3-[(2-methylpropan-2-yl)oxy]-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]amino]pentan-2-yl]amino]butan-2-yl]carbamate (PubChem CID 89275215) has the molecular formula C30H44N4O7 and a molecular weight of 572.70 g/mol. Its IUPAC name is benzyl N-[(2S)-3-[(2-methylpropan-2-yl)oxy]-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]amino]pentan-2-yl]amino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-[(2-methylpropan-2-yl)oxy]-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]amino]pentan-2-yl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 89275215 |
| Molecular Formula | C30H44N4O7 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | benzyl N-[(2S)-3-[(2-methylpropan-2-yl)oxy]-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]amino]pentan-2-yl]amino]butan-2-yl]carbamate |
| SMILES | C=CC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
| InChI | InChI=1S/C30H44N4O7/c1-7-12-22(27(37)33-23(24(35)8-2)17-21-15-16-31-26(21)36)32-28(38)25(19(3)41-30(4,5)6)34-29(39)40-18-20-13-10-9-11-14-20/h8-11,13-14,19,21-23,25H,2,7,12,15-18H2,1,3-6H3,(H,31,36)(H,32,38)(H,33,37)(H,34,39)/t19?,21-,22-,23-,25-/m0/s1 |
| InChIKey | HWRQFKYLGIVJJN-SPNCBHAUSA-N |
| XLogP | 2.54 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|