C33H44O8 — CID 89275499
[(5R,10S,12S,13R,14R,17R)-4,4,5,10,13,14-hexamethyl-17-[(2R)-6-methyl-4,7-dioxoheptan-2-yl]-3,7,11,15-tetraoxo-1,2,6,12,16,17-hexahydrocyclopenta[a]phenanthren-12-yl] acetate (PubChem CID 89275499) has the molecular formula C33H44O8 and a molecular weight of 568.71 g/mol. Its IUPAC name is [(5R,10S,12S,13R,14R,17R)-4,4,5,10,13,14-hexamethyl-17-[(2R)-6-methyl-4,7-dioxoheptan-2-yl]-3,7,11,15-tetraoxo-1,2,6,12,16,17-hexahydrocyclopenta[a]phenanthren-12-yl] acetate.
| Compound Name | [(5R,10S,12S,13R,14R,17R)-4,4,5,10,13,14-hexamethyl-17-[(2R)-6-methyl-4,7-dioxoheptan-2-yl]-3,7,11,15-tetraoxo-1,2,6,12,16,17-hexahydrocyclopenta[a]phenanthren-12-yl] acetate |
|---|---|
| PubChem CID | 89275499 |
| Molecular Formula | C33H44O8 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | [(5R,10S,12S,13R,14R,17R)-4,4,5,10,13,14-hexamethyl-17-[(2R)-6-methyl-4,7-dioxoheptan-2-yl]-3,7,11,15-tetraoxo-1,2,6,12,16,17-hexahydrocyclopenta[a]phenanthren-12-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)C2=C(C(=O)C[C@@]3(C)C(C)(C)C(=O)CC[C@]23C)[C@]2(C)C(=O)C[C@H]([C@H](C)CC(=O)CC(C)C=O)[C@@]12C |
| InChI | InChI=1S/C33H44O8/c1-17(16-34)12-20(36)13-18(2)21-14-24(39)33(9)25-22(37)15-31(7)29(4,5)23(38)10-11-30(31,6)26(25)27(40)28(32(21,33)8)41-19(3)35/h16-18,21,28H,10-15H2,1-9H3/t17?,18-,21-,28-,30-,31+,32+,33+/m1/s1 |
| InChIKey | PAIGIMYLWPYHLZ-REUGZTTCSA-N |
| XLogP | 4.59 |
| TPSA | 128.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|