C15H17Cl2NO2 — CID 89275510
3-[3-(2,6-dichlorophenyl)-5-propan-2-yl-4,5-dihydro-1,2-oxazol-4-yl]propanal (PubChem CID 89275510) has the molecular formula C15H17Cl2NO2 and a molecular weight of 314.21 g/mol. Its IUPAC name is 3-[3-(2,6-dichlorophenyl)-5-propan-2-yl-4,5-dihydro-1,2-oxazol-4-yl]propanal.
| Compound Name | 3-[3-(2,6-dichlorophenyl)-5-propan-2-yl-4,5-dihydro-1,2-oxazol-4-yl]propanal |
|---|---|
| PubChem CID | 89275510 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-[3-(2,6-dichlorophenyl)-5-propan-2-yl-4,5-dihydro-1,2-oxazol-4-yl]propanal |
| SMILES | CC(C)C1ON=C(c2c(Cl)cccc2Cl)C1CCC=O |
| InChI | InChI=1S/C15H17Cl2NO2/c1-9(2)15-10(5-4-8-19)14(18-20-15)13-11(16)6-3-7-12(13)17/h3,6-10,15H,4-5H2,1-2H3 |
| InChIKey | KZKKFROUTNLIMI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|