C9H17N5 — CID 89275674
(1Z,3E)-4-(methylideneamino)-4-piperazin-1-ylbuta-1,3-diene-1,3-diamine (PubChem CID 89275674) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is (1Z,3E)-4-(methylideneamino)-4-piperazin-1-ylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1Z,3E)-4-(methylideneamino)-4-piperazin-1-ylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 89275674 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | (1Z,3E)-4-(methylideneamino)-4-piperazin-1-ylbuta-1,3-diene-1,3-diamine |
| SMILES | C=N/C(=C(N)\C=C/N)N1CCNCC1 |
| InChI | InChI=1S/C9H17N5/c1-12-9(8(11)2-3-10)14-6-4-13-5-7-14/h2-3,13H,1,4-7,10-11H2/b3-2-,9-8- |
| InChIKey | CUXCGDOGFKFXDN-FUOWLQLWSA-N |
| XLogP | -0.81 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|