C21H31NO2 — CID 89275723
[(1R,2R,4R,6R,7R,11R,14E,18R)-14-hydroxyimino-7,18-dimethyl-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-enyl]methanol (PubChem CID 89275723) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is [(1R,2R,4R,6R,7R,11R,14E,18R)-14-hydroxyimino-7,18-dimethyl-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-enyl]methanol.
| Compound Name | [(1R,2R,4R,6R,7R,11R,14E,18R)-14-hydroxyimino-7,18-dimethyl-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-enyl]methanol |
|---|---|
| PubChem CID | 89275723 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | [(1R,2R,4R,6R,7R,11R,14E,18R)-14-hydroxyimino-7,18-dimethyl-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-enyl]methanol |
| SMILES | C[C@@H]1CC2=C/C(=N/O)CC[C@@H]2C2CC[C@]3(C)[C@H](C[C@@H]4C[C@@]43CO)[C@@H]21 |
| InChI | InChI=1S/C21H31NO2/c1-12-7-13-8-15(22-24)3-4-16(13)17-5-6-20(2)18(19(12)17)9-14-10-21(14,20)11-23/h8,12,14,16-19,23-24H,3-7,9-11H2,1-2H3/b22-15+/t12-,14-,16+,17?,18-,19-,20-,21-/m1/s1 |
| InChIKey | JOGVIGQGJCSRFS-YURAXICRSA-N |
| XLogP | 4.24 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|