C22H34Cl2N10O — CID 89275728
3,5-diamino-6-chloro-N-[N-chloro-N'-[4-[1-[4-(1H-imidazol-2-yl)butyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 89275728) has the molecular formula C22H34Cl2N10O and a molecular weight of 525.49 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N-chloro-N'-[4-[1-[4-(1H-imidazol-2-yl)butyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N-chloro-N'-[4-[1-[4-(1H-imidazol-2-yl)butyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 89275728 |
| Molecular Formula | C22H34Cl2N10O |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N-chloro-N'-[4-[1-[4-(1H-imidazol-2-yl)butyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | Nc1nc(N)c(C(=O)N/C(=N/CCCCC2CCN(CCCCc3ncc[nH]3)CC2)NCl)nc1Cl |
| InChI | InChI=1S/C22H34Cl2N10O/c23-18-20(26)31-19(25)17(30-18)21(35)32-22(33-24)29-9-3-1-5-15-7-13-34(14-8-15)12-4-2-6-16-27-10-11-28-16/h10-11,15H,1-9,12-14H2,(H,27,28)(H4,25,26,31)(H2,29,32,33,35) |
| InChIKey | PTJLULWCHDIVHI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 163.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|