C21H33Cl2N11O — CID 89275730
3,5-diamino-6-chloro-N-[N-chloro-N'-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 89275730) has the molecular formula C21H33Cl2N11O and a molecular weight of 526.48 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N-chloro-N'-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N-chloro-N'-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 89275730 |
| Molecular Formula | C21H33Cl2N11O |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N-chloro-N'-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | Nc1nc(N)c(C(=O)N/C(=N/CCCCN2CCN(CCCCc3ncc[nH]3)CC2)NCl)nc1Cl |
| InChI | InChI=1S/C21H33Cl2N11O/c22-17-19(25)30-18(24)16(29-17)20(35)31-21(32-23)28-6-2-4-10-34-13-11-33(12-14-34)9-3-1-5-15-26-7-8-27-15/h7-8H,1-6,9-14H2,(H,26,27)(H4,24,25,30)(H2,28,31,32,35) |
| InChIKey | SZYLINDXFWTNAQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 166.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|