C11H19N3 — CID 89275770
(2E,4E)-4-(1,3-diazinan-1-yl)hepta-2,4,6-trien-3-amine (PubChem CID 89275770) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,4E)-4-(1,3-diazinan-1-yl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-4-(1,3-diazinan-1-yl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 89275770 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (2E,4E)-4-(1,3-diazinan-1-yl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(C(\N)=C/C)/N1CCCNC1 |
| InChI | InChI=1S/C11H19N3/c1-3-6-11(10(12)4-2)14-8-5-7-13-9-14/h3-4,6,13H,1,5,7-9,12H2,2H3/b10-4+,11-6+ |
| InChIKey | YFFCDWJPXDWRIP-MCIRJAFSSA-N |
| XLogP | 1.17 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|