C29H48N3O2P — CID 89276040
3-[1-[(4R)-4-[(3R,5R,10S,13R,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]triazol-4-yl]-2-phosphanylpropanal (PubChem CID 89276040) has the molecular formula C29H48N3O2P and a molecular weight of 501.70 g/mol. Its IUPAC name is 3-[1-[(4R)-4-[(3R,5R,10S,13R,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]triazol-4-yl]-2-phosphanylpropanal.
| Compound Name | 3-[1-[(4R)-4-[(3R,5R,10S,13R,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]triazol-4-yl]-2-phosphanylpropanal |
|---|---|
| PubChem CID | 89276040 |
| Molecular Formula | C29H48N3O2P |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.35 |
| IUPAC Name | 3-[1-[(4R)-4-[(3R,5R,10S,13R,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]triazol-4-yl]-2-phosphanylpropanal |
| SMILES | C[C@H](CCCn1cc(CC(P)C=O)nn1)C1CC[C@H]2C3CC[C@@H]4C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C29H48N3O2P/c1-19(5-4-14-32-17-21(30-31-32)16-23(35)18-33)25-8-9-26-24-7-6-20-15-22(34)10-12-28(20,2)27(24)11-13-29(25,26)3/h17-20,22-27,34H,4-16,35H2,1-3H3/t19-,20-,22-,23?,24?,25?,26+,27?,28+,29-/m1/s1 |
| InChIKey | AQYISPZDXAYACW-AOEDYGGCSA-N |
| XLogP | 5.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|