About CID 89276042
CID 89276042 (PubChem CID 89276042) has the molecular formula C8H12BClO
and a molecular weight of 170.45 g/mol.
Molecular Properties
| Compound Name | CID 89276042 |
| PubChem CID | 89276042 |
| Molecular Formula | C8H12BClO |
| Molecular Weight | 170.45 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | — |
| SMILES | [B]C(C(=O)Cl)C1CCCCC1 |
| InChI | InChI=1S/C8H12BClO/c9-7(8(10)11)6-4-2-1-3-5-6/h6-7H,1-5H2 |
| InChIKey | LJQBYDXIHJEEJT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89276042 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89276042?
The IUPAC name of CID 89276042 (CID 89276042) is not available.
What is the SMILES notation for CID 89276042?
The canonical SMILES for CID 89276042 is [B]C(C(=O)Cl)C1CCCCC1.
What is the InChIKey of CID 89276042?
The InChIKey is LJQBYDXIHJEEJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BClO/c9-7(8(10)11)6-4-2-1-3-5-6/h6-7H,1-5H2.
What are the key properties of CID 89276042?
CID 89276042 has a molecular weight of 170.45 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89276042 is sourced from PubChem (CID 89276042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).