C16H20S — CID 89276075
2,5-bis[(2E,4Z)-hexa-2,4-dien-2-yl]thiophene (PubChem CID 89276075) has the molecular formula C16H20S and a molecular weight of 244.40 g/mol. Its IUPAC name is 2,5-bis[(2E,4Z)-hexa-2,4-dien-2-yl]thiophene.
| Compound Name | 2,5-bis[(2E,4Z)-hexa-2,4-dien-2-yl]thiophene |
|---|---|
| PubChem CID | 89276075 |
| Molecular Formula | C16H20S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2,5-bis[(2E,4Z)-hexa-2,4-dien-2-yl]thiophene |
| SMILES | C/C=C\C=C(/C)c1ccc(/C(C)=C/C=C\C)s1 |
| InChI | InChI=1S/C16H20S/c1-5-7-9-13(3)15-11-12-16(17-15)14(4)10-8-6-2/h5-12H,1-4H3/b7-5-,8-6-,13-9+,14-10+ |
| InChIKey | CXOQGYYXMRPAAT-HRFZYNDSSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|