C20H20N2O2 — CID 8927653
N-(2,3-dihydro-1H-inden-5-yl)-2-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 8927653) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 8927653 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)c1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C20H20N2O2/c23-19-9-4-12-22(19)18-8-2-1-7-17(18)20(24)21-16-11-10-14-5-3-6-15(14)13-16/h1-2,7-8,10-11,13H,3-6,9,12H2,(H,21,24) |
| InChIKey | IQCRGNTVMAIQOE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |