C9H13NO3 — CID 89276547
5-hydroxy-2-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 89276547) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 5-hydroxy-2-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 89276547 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-hydroxy-2-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CN1C(=O)C2CCC(O)CC2C1=O |
| InChI | InChI=1S/C9H13NO3/c1-10-8(12)6-3-2-5(11)4-7(6)9(10)13/h5-7,11H,2-4H2,1H3 |
| InChIKey | USAHAOLVNKXWIU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|