C18H30O4 — CID 89276744
[(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]methanol (PubChem CID 89276744) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is [(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]methanol.
| Compound Name | [(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]methanol |
|---|---|
| PubChem CID | 89276744 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]methanol |
| SMILES | C[C@@]1(C2CC3CCCC(C3)C2)OOC2(CCC(CO)CC2)O1 |
| InChI | InChI=1S/C18H30O4/c1-17(16-10-14-3-2-4-15(9-14)11-16)20-18(22-21-17)7-5-13(12-19)6-8-18/h13-16,19H,2-12H2,1H3/t13?,14?,15?,16?,17-,18?/m0/s1 |
| InChIKey | DMDBTBSXEJGGRN-NFSPANSCSA-N |
| XLogP | 3.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|