About N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide
N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide (PubChem CID 89276773) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide.
Molecular Properties
| Compound Name | N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide |
| PubChem CID | 89276773 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide |
| SMILES | CC1C=CC(C(C)C(=O)NC=O)O1 |
| InChI | InChI=1S/C9H13NO3/c1-6-3-4-8(13-6)7(2)9(12)10-5-11/h3-8H,1-2H3,(H,10,11,12) |
| InChIKey | NPFIFZQKITXBRT-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide?
The IUPAC name of N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide (CID 89276773) is N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide.
What is the SMILES notation for N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide?
The canonical SMILES for N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide is CC1C=CC(C(C)C(=O)NC=O)O1.
What is the InChIKey of N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide?
The InChIKey is NPFIFZQKITXBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-6-3-4-8(13-6)7(2)9(12)10-5-11/h3-8H,1-2H3,(H,10,11,12).
What are the key properties of N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide?
N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide has a molecular weight of 183.21 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-formyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide is sourced from PubChem (CID 89276773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).