About S-methyl 3-hydroxy-2,4-dimethylhexanethioate
S-methyl 3-hydroxy-2,4-dimethylhexanethioate (PubChem CID 89276840) has the molecular formula C9H18O2S
and a molecular weight of 190.31 g/mol. Its IUPAC name is S-methyl 3-hydroxy-2,4-dimethylhexanethioate.
Molecular Properties
| Compound Name | S-methyl 3-hydroxy-2,4-dimethylhexanethioate |
| PubChem CID | 89276840 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | S-methyl 3-hydroxy-2,4-dimethylhexanethioate |
| SMILES | CCC(C)C(O)C(C)C(=O)SC |
| InChI | InChI=1S/C9H18O2S/c1-5-6(2)8(10)7(3)9(11)12-4/h6-8,10H,5H2,1-4H3 |
| InChIKey | FPARHAFSXJFYCC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 3-hydroxy-2,4-dimethylhexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 3-hydroxy-2,4-dimethylhexanethioate?
The IUPAC name of S-methyl 3-hydroxy-2,4-dimethylhexanethioate (CID 89276840) is S-methyl 3-hydroxy-2,4-dimethylhexanethioate.
What is the SMILES notation for S-methyl 3-hydroxy-2,4-dimethylhexanethioate?
The canonical SMILES for S-methyl 3-hydroxy-2,4-dimethylhexanethioate is CCC(C)C(O)C(C)C(=O)SC.
What is the InChIKey of S-methyl 3-hydroxy-2,4-dimethylhexanethioate?
The InChIKey is FPARHAFSXJFYCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2S/c1-5-6(2)8(10)7(3)9(11)12-4/h6-8,10H,5H2,1-4H3.
What are the key properties of S-methyl 3-hydroxy-2,4-dimethylhexanethioate?
S-methyl 3-hydroxy-2,4-dimethylhexanethioate has a molecular weight of 190.31 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 3-hydroxy-2,4-dimethylhexanethioate is sourced from PubChem (CID 89276840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).