C8H13N3O4 — CID 89277024
1-N,3-N-bis(methylperoxy)benzene-1,3,5-triamine (PubChem CID 89277024) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 1-N,3-N-bis(methylperoxy)benzene-1,3,5-triamine.
| Compound Name | 1-N,3-N-bis(methylperoxy)benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 89277024 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-N,3-N-bis(methylperoxy)benzene-1,3,5-triamine |
| SMILES | COONc1cc(N)cc(NOOC)c1 |
| InChI | InChI=1S/C8H13N3O4/c1-12-14-10-7-3-6(9)4-8(5-7)11-15-13-2/h3-5,10-11H,9H2,1-2H3 |
| InChIKey | DQBMWCHBVJPABD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|