About (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine
(Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine (PubChem CID 89277218) has the molecular formula C6H9ClN2
and a molecular weight of 144.60 g/mol. Its IUPAC name is (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine.
Molecular Properties
| Compound Name | (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine |
| PubChem CID | 89277218 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine |
| SMILES | C=C(Cl)/C=C\C(C)=N/N |
| InChI | InChI=1S/C6H9ClN2/c1-5(7)3-4-6(2)9-8/h3-4H,1,8H2,2H3/b4-3-,9-6- |
| InChIKey | FZFHUUCDQYXMSF-UBCGXMOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine?
The IUPAC name of (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine (CID 89277218) is (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine.
What is the SMILES notation for (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine?
The canonical SMILES for (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine is C=C(Cl)/C=C\C(C)=N/N.
What is the InChIKey of (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine?
The InChIKey is FZFHUUCDQYXMSF-UBCGXMOYSA-N. The full InChI is InChI=1S/C6H9ClN2/c1-5(7)3-4-6(2)9-8/h3-4H,1,8H2,2H3/b4-3-,9-6-.
What are the key properties of (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine?
(Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine has a molecular weight of 144.60 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-[(3Z)-5-chlorohexa-3,5-dien-2-ylidene]hydrazine is sourced from PubChem (CID 89277218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).